C14H18N2O5S — CID 11927055
[(2S)-1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 2-[(R)-methylsulfinyl]benzoate (PubChem CID 11927055) has the molecular formula C14H18N2O5S and a molecular weight of 326.37 g/mol. Its IUPAC name is [(2S)-1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 2-[(R)-methylsulfinyl]benzoate.
| Compound Name | [(2S)-1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 2-[(R)-methylsulfinyl]benzoate |
|---|---|
| PubChem CID | 11927055 |
| Molecular Formula | C14H18N2O5S |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | [(2S)-1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 2-[(R)-methylsulfinyl]benzoate |
| SMILES | CCNC(=O)NC(=O)[C@H](C)OC(=O)c1ccccc1[S@@](C)=O |
| InChI | InChI=1S/C14H18N2O5S/c1-4-15-14(19)16-12(17)9(2)21-13(18)10-7-5-6-8-11(10)22(3)20/h5-9H,4H2,1-3H3,(H2,15,16,17,19)/t9-,22+/m0/s1 |
| InChIKey | QCDWDRVXTAMZGQ-GTUYJWLHSA-N |
| XLogP | 0.81 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |