C22H19ClN2O3 — CID 7867629
[(2R)-1-(benzhydrylamino)-1-oxopropan-2-yl] 2-chloropyridine-3-carboxylate (PubChem CID 7867629) has the molecular formula C22H19ClN2O3 and a molecular weight of 394.86 g/mol. Its IUPAC name is [(2R)-1-(benzhydrylamino)-1-oxopropan-2-yl] 2-chloropyridine-3-carboxylate.
| Compound Name | [(2R)-1-(benzhydrylamino)-1-oxopropan-2-yl] 2-chloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 7867629 |
| Molecular Formula | C22H19ClN2O3 |
| Molecular Weight | 394.86 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | [(2R)-1-(benzhydrylamino)-1-oxopropan-2-yl] 2-chloropyridine-3-carboxylate |
| SMILES | C[C@@H](OC(=O)c1cccnc1Cl)C(=O)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H19ClN2O3/c1-15(28-22(27)18-13-8-14-24-20(18)23)21(26)25-19(16-9-4-2-5-10-16)17-11-6-3-7-12-17/h2-15,19H,1H3,(H,25,26)/t15-/m1/s1 |
| InChIKey | WITDYFSZXARPGB-OAHLLOKOSA-N |
| XLogP | 4.19 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.86 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|