C23H29N3O4 — CID 7602848
[(2S)-1-oxo-1-(4-piperidin-1-ylanilino)propan-2-yl] 2-(2-hydroxyethylamino)benzoate (PubChem CID 7602848) has the molecular formula C23H29N3O4 and a molecular weight of 411.50 g/mol. Its IUPAC name is [(2S)-1-oxo-1-(4-piperidin-1-ylanilino)propan-2-yl] 2-(2-hydroxyethylamino)benzoate.
| Compound Name | [(2S)-1-oxo-1-(4-piperidin-1-ylanilino)propan-2-yl] 2-(2-hydroxyethylamino)benzoate |
|---|---|
| PubChem CID | 7602848 |
| Molecular Formula | C23H29N3O4 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | [(2S)-1-oxo-1-(4-piperidin-1-ylanilino)propan-2-yl] 2-(2-hydroxyethylamino)benzoate |
| SMILES | C[C@H](OC(=O)c1ccccc1NCCO)C(=O)Nc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C23H29N3O4/c1-17(30-23(29)20-7-3-4-8-21(20)24-13-16-27)22(28)25-18-9-11-19(12-10-18)26-14-5-2-6-15-26/h3-4,7-12,17,24,27H,2,5-6,13-16H2,1H3,(H,25,28)/t17-/m0/s1 |
| InChIKey | NNVJFVVNFPWXOX-KRWDZBQOSA-N |
| XLogP | 3.27 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|