C21H26N2O4 — CID 8860962
[(2R)-1-oxo-1-(4-piperidin-1-ylanilino)propan-2-yl] 2,5-dimethylfuran-3-carboxylate (PubChem CID 8860962) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is [(2R)-1-oxo-1-(4-piperidin-1-ylanilino)propan-2-yl] 2,5-dimethylfuran-3-carboxylate.
| Compound Name | [(2R)-1-oxo-1-(4-piperidin-1-ylanilino)propan-2-yl] 2,5-dimethylfuran-3-carboxylate |
|---|---|
| PubChem CID | 8860962 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | [(2R)-1-oxo-1-(4-piperidin-1-ylanilino)propan-2-yl] 2,5-dimethylfuran-3-carboxylate |
| SMILES | Cc1cc(C(=O)O[C@H](C)C(=O)Nc2ccc(N3CCCCC3)cc2)c(C)o1 |
| InChI | InChI=1S/C21H26N2O4/c1-14-13-19(15(2)26-14)21(25)27-16(3)20(24)22-17-7-9-18(10-8-17)23-11-5-4-6-12-23/h7-10,13,16H,4-6,11-12H2,1-3H3,(H,22,24)/t16-/m1/s1 |
| InChIKey | RCCBCKYDTZTUFK-MRXNPFEDSA-N |
| XLogP | 4.07 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|