C24H19NO6 — CID 8861064
[(2S)-1-[(9,10-dioxoanthracen-2-yl)amino]-1-oxopropan-2-yl] 2,5-dimethylfuran-3-carboxylate (PubChem CID 8861064) has the molecular formula C24H19NO6 and a molecular weight of 417.42 g/mol. Its IUPAC name is [(2S)-1-[(9,10-dioxoanthracen-2-yl)amino]-1-oxopropan-2-yl] 2,5-dimethylfuran-3-carboxylate.
| Compound Name | [(2S)-1-[(9,10-dioxoanthracen-2-yl)amino]-1-oxopropan-2-yl] 2,5-dimethylfuran-3-carboxylate |
|---|---|
| PubChem CID | 8861064 |
| Molecular Formula | C24H19NO6 |
| Molecular Weight | 417.42 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | [(2S)-1-[(9,10-dioxoanthracen-2-yl)amino]-1-oxopropan-2-yl] 2,5-dimethylfuran-3-carboxylate |
| SMILES | Cc1cc(C(=O)O[C@@H](C)C(=O)Nc2ccc3c(c2)C(=O)c2ccccc2C3=O)c(C)o1 |
| InChI | InChI=1S/C24H19NO6/c1-12-10-19(13(2)30-12)24(29)31-14(3)23(28)25-15-8-9-18-20(11-15)22(27)17-7-5-4-6-16(17)21(18)26/h4-11,14H,1-3H3,(H,25,28)/t14-/m0/s1 |
| InChIKey | VNKVIIXTCLONOJ-AWEZNQCLSA-N |
| XLogP | 3.86 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.42 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|