C28H20N2O6 — CID 41296538
[(2R)-1-[(9,10-dioxoanthracen-2-yl)amino]-1-oxopropan-2-yl] 5-methyl-2-phenyl-1,3-oxazole-4-carboxylate (PubChem CID 41296538) has the molecular formula C28H20N2O6 and a molecular weight of 480.48 g/mol. Its IUPAC name is [(2R)-1-[(9,10-dioxoanthracen-2-yl)amino]-1-oxopropan-2-yl] 5-methyl-2-phenyl-1,3-oxazole-4-carboxylate.
| Compound Name | [(2R)-1-[(9,10-dioxoanthracen-2-yl)amino]-1-oxopropan-2-yl] 5-methyl-2-phenyl-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 41296538 |
| Molecular Formula | C28H20N2O6 |
| Molecular Weight | 480.48 g/mol |
| Exact Mass | 480.13 |
| IUPAC Name | [(2R)-1-[(9,10-dioxoanthracen-2-yl)amino]-1-oxopropan-2-yl] 5-methyl-2-phenyl-1,3-oxazole-4-carboxylate |
| SMILES | Cc1oc(-c2ccccc2)nc1C(=O)O[C@H](C)C(=O)Nc1ccc2c(c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C28H20N2O6/c1-15-23(30-27(35-15)17-8-4-3-5-9-17)28(34)36-16(2)26(33)29-18-12-13-21-22(14-18)25(32)20-11-7-6-10-19(20)24(21)31/h3-14,16H,1-2H3,(H,29,33)/t16-/m1/s1 |
| InChIKey | OACXZNPPQVRHMV-MRXNPFEDSA-N |
| XLogP | 4.61 |
| TPSA | 115.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.48 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|