C23H17N3O5 — CID 42972971
[1-[(9,10-dioxoanthracen-2-yl)amino]-1-oxopropan-2-yl] 5-methylpyrazine-2-carboxylate (PubChem CID 42972971) has the molecular formula C23H17N3O5 and a molecular weight of 415.41 g/mol. Its IUPAC name is [1-[(9,10-dioxoanthracen-2-yl)amino]-1-oxopropan-2-yl] 5-methylpyrazine-2-carboxylate.
| Compound Name | [1-[(9,10-dioxoanthracen-2-yl)amino]-1-oxopropan-2-yl] 5-methylpyrazine-2-carboxylate |
|---|---|
| PubChem CID | 42972971 |
| Molecular Formula | C23H17N3O5 |
| Molecular Weight | 415.41 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | [1-[(9,10-dioxoanthracen-2-yl)amino]-1-oxopropan-2-yl] 5-methylpyrazine-2-carboxylate |
| SMILES | Cc1cnc(C(=O)OC(C)C(=O)Nc2ccc3c(c2)C(=O)c2ccccc2C3=O)cn1 |
| InChI | InChI=1S/C23H17N3O5/c1-12-10-25-19(11-24-12)23(30)31-13(2)22(29)26-14-7-8-17-18(9-14)21(28)16-6-4-3-5-15(16)20(17)27/h3-11,13H,1-2H3,(H,26,29) |
| InChIKey | HGEVKJLQJOBKSJ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 115.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.41 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|