C21H19NO5 — CID 7796781
[(2S)-1-[(9,10-dioxoanthracen-2-yl)amino]-1-oxopropan-2-yl] butanoate (PubChem CID 7796781) has the molecular formula C21H19NO5 and a molecular weight of 365.39 g/mol. Its IUPAC name is [(2S)-1-[(9,10-dioxoanthracen-2-yl)amino]-1-oxopropan-2-yl] butanoate.
| Compound Name | [(2S)-1-[(9,10-dioxoanthracen-2-yl)amino]-1-oxopropan-2-yl] butanoate |
|---|---|
| PubChem CID | 7796781 |
| Molecular Formula | C21H19NO5 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | [(2S)-1-[(9,10-dioxoanthracen-2-yl)amino]-1-oxopropan-2-yl] butanoate |
| SMILES | CCCC(=O)O[C@@H](C)C(=O)Nc1ccc2c(c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C21H19NO5/c1-3-6-18(23)27-12(2)21(26)22-13-9-10-16-17(11-13)20(25)15-8-5-4-7-14(15)19(16)24/h4-5,7-12H,3,6H2,1-2H3,(H,22,26)/t12-/m0/s1 |
| InChIKey | VAOKRNMMSQQSGQ-LBPRGKRZSA-N |
| XLogP | 3.13 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|