C26H21NO6 — CID 55316551
[1-[(9,10-dioxoanthracen-2-yl)amino]-1-oxopropan-2-yl] 3-phenoxypropanoate (PubChem CID 55316551) has the molecular formula C26H21NO6 and a molecular weight of 443.46 g/mol. Its IUPAC name is [1-[(9,10-dioxoanthracen-2-yl)amino]-1-oxopropan-2-yl] 3-phenoxypropanoate.
| Compound Name | [1-[(9,10-dioxoanthracen-2-yl)amino]-1-oxopropan-2-yl] 3-phenoxypropanoate |
|---|---|
| PubChem CID | 55316551 |
| Molecular Formula | C26H21NO6 |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | [1-[(9,10-dioxoanthracen-2-yl)amino]-1-oxopropan-2-yl] 3-phenoxypropanoate |
| SMILES | CC(OC(=O)CCOc1ccccc1)C(=O)Nc1ccc2c(c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C26H21NO6/c1-16(33-23(28)13-14-32-18-7-3-2-4-8-18)26(31)27-17-11-12-21-22(15-17)25(30)20-10-6-5-9-19(20)24(21)29/h2-12,15-16H,13-14H2,1H3,(H,27,31) |
| InChIKey | RDQYVSVBHJUHEN-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|