C27H23NO7 — CID 43028331
[1-[(9,10-dioxoanthracen-1-yl)amino]-1-oxopropan-2-yl] 3-(4-methoxyphenoxy)propanoate (PubChem CID 43028331) has the molecular formula C27H23NO7 and a molecular weight of 473.48 g/mol. Its IUPAC name is [1-[(9,10-dioxoanthracen-1-yl)amino]-1-oxopropan-2-yl] 3-(4-methoxyphenoxy)propanoate.
| Compound Name | [1-[(9,10-dioxoanthracen-1-yl)amino]-1-oxopropan-2-yl] 3-(4-methoxyphenoxy)propanoate |
|---|---|
| PubChem CID | 43028331 |
| Molecular Formula | C27H23NO7 |
| Molecular Weight | 473.48 g/mol |
| Exact Mass | 473.15 |
| IUPAC Name | [1-[(9,10-dioxoanthracen-1-yl)amino]-1-oxopropan-2-yl] 3-(4-methoxyphenoxy)propanoate |
| SMILES | COc1ccc(OCCC(=O)OC(C)C(=O)Nc2cccc3c2C(=O)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C27H23NO7/c1-16(35-23(29)14-15-34-18-12-10-17(33-2)11-13-18)27(32)28-22-9-5-8-21-24(22)26(31)20-7-4-3-6-19(20)25(21)30/h3-13,16H,14-15H2,1-2H3,(H,28,32) |
| InChIKey | FQGYNMAIKRALDR-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.48 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|