C28H22N2O5S — CID 43028275
[1-[(9,10-dioxoanthracen-1-yl)amino]-1-oxopropan-2-yl] 4-(1,3-benzothiazol-2-yl)butanoate (PubChem CID 43028275) has the molecular formula C28H22N2O5S and a molecular weight of 498.56 g/mol. Its IUPAC name is [1-[(9,10-dioxoanthracen-1-yl)amino]-1-oxopropan-2-yl] 4-(1,3-benzothiazol-2-yl)butanoate.
| Compound Name | [1-[(9,10-dioxoanthracen-1-yl)amino]-1-oxopropan-2-yl] 4-(1,3-benzothiazol-2-yl)butanoate |
|---|---|
| PubChem CID | 43028275 |
| Molecular Formula | C28H22N2O5S |
| Molecular Weight | 498.56 g/mol |
| Exact Mass | 498.12 |
| IUPAC Name | [1-[(9,10-dioxoanthracen-1-yl)amino]-1-oxopropan-2-yl] 4-(1,3-benzothiazol-2-yl)butanoate |
| SMILES | CC(OC(=O)CCCc1nc2ccccc2s1)C(=O)Nc1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C28H22N2O5S/c1-16(35-24(31)15-7-14-23-29-20-11-4-5-13-22(20)36-23)28(34)30-21-12-6-10-19-25(21)27(33)18-9-3-2-8-17(18)26(19)32/h2-6,8-13,16H,7,14-15H2,1H3,(H,30,34) |
| InChIKey | FIAZVHUOHKBCJS-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.56 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|