C30H24N2O5 — CID 41170561
[(2S)-1-[(9,10-dioxoanthracen-1-yl)amino]-1-oxopropan-2-yl] 2-(2,4-dimethylquinolin-3-yl)acetate (PubChem CID 41170561) has the molecular formula C30H24N2O5 and a molecular weight of 492.53 g/mol. Its IUPAC name is [(2S)-1-[(9,10-dioxoanthracen-1-yl)amino]-1-oxopropan-2-yl] 2-(2,4-dimethylquinolin-3-yl)acetate.
| Compound Name | [(2S)-1-[(9,10-dioxoanthracen-1-yl)amino]-1-oxopropan-2-yl] 2-(2,4-dimethylquinolin-3-yl)acetate |
|---|---|
| PubChem CID | 41170561 |
| Molecular Formula | C30H24N2O5 |
| Molecular Weight | 492.53 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | [(2S)-1-[(9,10-dioxoanthracen-1-yl)amino]-1-oxopropan-2-yl] 2-(2,4-dimethylquinolin-3-yl)acetate |
| SMILES | Cc1nc2ccccc2c(C)c1CC(=O)O[C@@H](C)C(=O)Nc1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C30H24N2O5/c1-16-19-9-6-7-13-24(19)31-17(2)23(16)15-26(33)37-18(3)30(36)32-25-14-8-12-22-27(25)29(35)21-11-5-4-10-20(21)28(22)34/h4-14,18H,15H2,1-3H3,(H,32,36)/t18-/m0/s1 |
| InChIKey | NXVKHWCDQQHQBG-SFHVURJKSA-N |
| XLogP | 4.74 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.53 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|