C22H19NO5 — CID 55372469
[1-[(9,10-dioxoanthracen-1-yl)amino]-1-oxopropan-2-yl] cyclobutanecarboxylate (PubChem CID 55372469) has the molecular formula C22H19NO5 and a molecular weight of 377.40 g/mol. Its IUPAC name is [1-[(9,10-dioxoanthracen-1-yl)amino]-1-oxopropan-2-yl] cyclobutanecarboxylate.
| Compound Name | [1-[(9,10-dioxoanthracen-1-yl)amino]-1-oxopropan-2-yl] cyclobutanecarboxylate |
|---|---|
| PubChem CID | 55372469 |
| Molecular Formula | C22H19NO5 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | [1-[(9,10-dioxoanthracen-1-yl)amino]-1-oxopropan-2-yl] cyclobutanecarboxylate |
| SMILES | CC(OC(=O)C1CCC1)C(=O)Nc1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C22H19NO5/c1-12(28-22(27)13-6-4-7-13)21(26)23-17-11-5-10-16-18(17)20(25)15-9-3-2-8-14(15)19(16)24/h2-3,5,8-13H,4,6-7H2,1H3,(H,23,26) |
| InChIKey | RUAJEKCULSIGMU-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|