C16H21NO3 — CID 154754678
[1-(2-methylanilino)-1-oxopropan-2-yl] cyclopentanecarboxylate (PubChem CID 154754678) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is [1-(2-methylanilino)-1-oxopropan-2-yl] cyclopentanecarboxylate.
| Compound Name | [1-(2-methylanilino)-1-oxopropan-2-yl] cyclopentanecarboxylate |
|---|---|
| PubChem CID | 154754678 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | [1-(2-methylanilino)-1-oxopropan-2-yl] cyclopentanecarboxylate |
| SMILES | Cc1ccccc1NC(=O)C(C)OC(=O)C1CCCC1 |
| InChI | InChI=1S/C16H21NO3/c1-11-7-3-6-10-14(11)17-15(18)12(2)20-16(19)13-8-4-5-9-13/h3,6-7,10,12-13H,4-5,8-9H2,1-2H3,(H,17,18) |
| InChIKey | SGUBWBPELUWBEO-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |