C17H21NO4 — CID 7717472
[(2R)-1-(3-acetylanilino)-1-oxopropan-2-yl] cyclopentanecarboxylate (PubChem CID 7717472) has the molecular formula C17H21NO4 and a molecular weight of 303.36 g/mol. Its IUPAC name is [(2R)-1-(3-acetylanilino)-1-oxopropan-2-yl] cyclopentanecarboxylate.
| Compound Name | [(2R)-1-(3-acetylanilino)-1-oxopropan-2-yl] cyclopentanecarboxylate |
|---|---|
| PubChem CID | 7717472 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | [(2R)-1-(3-acetylanilino)-1-oxopropan-2-yl] cyclopentanecarboxylate |
| SMILES | CC(=O)c1cccc(NC(=O)[C@@H](C)OC(=O)C2CCCC2)c1 |
| InChI | InChI=1S/C17H21NO4/c1-11(19)14-8-5-9-15(10-14)18-16(20)12(2)22-17(21)13-6-3-4-7-13/h5,8-10,12-13H,3-4,6-7H2,1-2H3,(H,18,20)/t12-/m1/s1 |
| InChIKey | QYJCUGJNQDTMRL-GFCCVEGCSA-N |
| XLogP | 2.95 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |