C22H24N2O5S — CID 46819320
[1-(3-acetylanilino)-1-oxopropan-2-yl] 1-(thiophene-2-carbonyl)piperidine-4-carboxylate (PubChem CID 46819320) has the molecular formula C22H24N2O5S and a molecular weight of 428.51 g/mol. Its IUPAC name is [1-(3-acetylanilino)-1-oxopropan-2-yl] 1-(thiophene-2-carbonyl)piperidine-4-carboxylate.
| Compound Name | [1-(3-acetylanilino)-1-oxopropan-2-yl] 1-(thiophene-2-carbonyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 46819320 |
| Molecular Formula | C22H24N2O5S |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | [1-(3-acetylanilino)-1-oxopropan-2-yl] 1-(thiophene-2-carbonyl)piperidine-4-carboxylate |
| SMILES | CC(=O)c1cccc(NC(=O)C(C)OC(=O)C2CCN(C(=O)c3cccs3)CC2)c1 |
| InChI | InChI=1S/C22H24N2O5S/c1-14(25)17-5-3-6-18(13-17)23-20(26)15(2)29-22(28)16-8-10-24(11-9-16)21(27)19-7-4-12-30-19/h3-7,12-13,15-16H,8-11H2,1-2H3,(H,23,26) |
| InChIKey | DFZWQEJFPVFACZ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |