C22H21N3O3S2 — CID 31520919
1-(thiophene-2-carbonyl)-N-[3-(thiophene-2-carbonylamino)phenyl]piperidine-4-carboxamide (PubChem CID 31520919) has the molecular formula C22H21N3O3S2 and a molecular weight of 439.56 g/mol. Its IUPAC name is 1-(thiophene-2-carbonyl)-N-[3-(thiophene-2-carbonylamino)phenyl]piperidine-4-carboxamide.
| Compound Name | 1-(thiophene-2-carbonyl)-N-[3-(thiophene-2-carbonylamino)phenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 31520919 |
| Molecular Formula | C22H21N3O3S2 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | 1-(thiophene-2-carbonyl)-N-[3-(thiophene-2-carbonylamino)phenyl]piperidine-4-carboxamide |
| SMILES | O=C(Nc1cccc(NC(=O)C2CCN(C(=O)c3cccs3)CC2)c1)c1cccs1 |
| InChI | InChI=1S/C22H21N3O3S2/c26-20(15-8-10-25(11-9-15)22(28)19-7-3-13-30-19)23-16-4-1-5-17(14-16)24-21(27)18-6-2-12-29-18/h1-7,12-15H,8-11H2,(H,23,26)(H,24,27) |
| InChIKey | LCWUIEIDBQPTAB-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |