C21H27N3O4S2 — CID 46510399
N-[3-(butylsulfamoyl)phenyl]-1-(thiophene-2-carbonyl)piperidine-4-carboxamide (PubChem CID 46510399) has the molecular formula C21H27N3O4S2 and a molecular weight of 449.60 g/mol. Its IUPAC name is N-[3-(butylsulfamoyl)phenyl]-1-(thiophene-2-carbonyl)piperidine-4-carboxamide.
| Compound Name | N-[3-(butylsulfamoyl)phenyl]-1-(thiophene-2-carbonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 46510399 |
| Molecular Formula | C21H27N3O4S2 |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | N-[3-(butylsulfamoyl)phenyl]-1-(thiophene-2-carbonyl)piperidine-4-carboxamide |
| SMILES | CCCCNS(=O)(=O)c1cccc(NC(=O)C2CCN(C(=O)c3cccs3)CC2)c1 |
| InChI | InChI=1S/C21H27N3O4S2/c1-2-3-11-22-30(27,28)18-7-4-6-17(15-18)23-20(25)16-9-12-24(13-10-16)21(26)19-8-5-14-29-19/h4-8,14-16,22H,2-3,9-13H2,1H3,(H,23,25) |
| InChIKey | PFHNGIQIWXVMJC-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|