C23H29N3O4S2 — CID 17224205
N-[4-(cyclohexylsulfamoyl)phenyl]-1-(thiophene-2-carbonyl)piperidine-4-carboxamide (PubChem CID 17224205) has the molecular formula C23H29N3O4S2 and a molecular weight of 475.64 g/mol. Its IUPAC name is N-[4-(cyclohexylsulfamoyl)phenyl]-1-(thiophene-2-carbonyl)piperidine-4-carboxamide.
| Compound Name | N-[4-(cyclohexylsulfamoyl)phenyl]-1-(thiophene-2-carbonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 17224205 |
| Molecular Formula | C23H29N3O4S2 |
| Molecular Weight | 475.64 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | N-[4-(cyclohexylsulfamoyl)phenyl]-1-(thiophene-2-carbonyl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)NC2CCCCC2)cc1)C1CCN(C(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C23H29N3O4S2/c27-22(17-12-14-26(15-13-17)23(28)21-7-4-16-31-21)24-18-8-10-20(11-9-18)32(29,30)25-19-5-2-1-3-6-19/h4,7-11,16-17,19,25H,1-3,5-6,12-15H2,(H,24,27) |
| InChIKey | RZFQDXHQXCDMFO-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.64 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |