C16H11NO4 — CID 4161864
methyl N-(9,10-dioxoanthracen-1-yl)carbamate (PubChem CID 4161864) has the molecular formula C16H11NO4 and a molecular weight of 281.27 g/mol. Its IUPAC name is methyl N-(9,10-dioxoanthracen-1-yl)carbamate.
| Compound Name | methyl N-(9,10-dioxoanthracen-1-yl)carbamate |
|---|---|
| PubChem CID | 4161864 |
| Molecular Formula | C16H11NO4 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | methyl N-(9,10-dioxoanthracen-1-yl)carbamate |
| SMILES | COC(=O)Nc1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C16H11NO4/c1-21-16(20)17-12-8-4-7-11-13(12)15(19)10-6-3-2-5-9(10)14(11)18/h2-8H,1H3,(H,17,20) |
| InChIKey | GTCKJXWUHLBZSE-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|