C21H20N2O5 — CID 4839814
methyl 2-[(9,10-dioxoanthracen-1-yl)carbamoylamino]-3-methylbutanoate (PubChem CID 4839814) has the molecular formula C21H20N2O5 and a molecular weight of 380.40 g/mol. Its IUPAC name is methyl 2-[(9,10-dioxoanthracen-1-yl)carbamoylamino]-3-methylbutanoate.
| Compound Name | methyl 2-[(9,10-dioxoanthracen-1-yl)carbamoylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 4839814 |
| Molecular Formula | C21H20N2O5 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | methyl 2-[(9,10-dioxoanthracen-1-yl)carbamoylamino]-3-methylbutanoate |
| SMILES | COC(=O)C(NC(=O)Nc1cccc2c1C(=O)c1ccccc1C2=O)C(C)C |
| InChI | InChI=1S/C21H20N2O5/c1-11(2)17(20(26)28-3)23-21(27)22-15-10-6-9-14-16(15)19(25)13-8-5-4-7-12(13)18(14)24/h4-11,17H,1-3H3,(H2,22,23,27) |
| InChIKey | SLECOVMRPXFJPX-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|