C15H10N2O2S — CID 82030669
(9,10-dioxoanthracen-1-yl)thiourea (PubChem CID 82030669) has the molecular formula C15H10N2O2S and a molecular weight of 282.32 g/mol. Its IUPAC name is (9,10-dioxoanthracen-1-yl)thiourea.
| Compound Name | (9,10-dioxoanthracen-1-yl)thiourea |
|---|---|
| PubChem CID | 82030669 |
| Molecular Formula | C15H10N2O2S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | (9,10-dioxoanthracen-1-yl)thiourea |
| SMILES | NC(=S)Nc1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C15H10N2O2S/c16-15(20)17-11-7-3-6-10-12(11)14(19)9-5-2-1-4-8(9)13(10)18/h1-7H,(H3,16,17,20) |
| InChIKey | VOJWCDRMQULURT-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|