C16H10BrNO3 — CID 24884684
2-bromo-N-(9,10-dioxoanthracen-1-yl)acetamide (PubChem CID 24884684) has the molecular formula C16H10BrNO3 and a molecular weight of 344.16 g/mol. Its IUPAC name is 2-bromo-N-(9,10-dioxoanthracen-1-yl)acetamide.
| Compound Name | 2-bromo-N-(9,10-dioxoanthracen-1-yl)acetamide |
|---|---|
| PubChem CID | 24884684 |
| Molecular Formula | C16H10BrNO3 |
| Molecular Weight | 344.16 g/mol |
| Exact Mass | 342.98 |
| IUPAC Name | 2-bromo-N-(9,10-dioxoanthracen-1-yl)acetamide |
| SMILES | O=C(CBr)Nc1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C16H10BrNO3/c17-8-13(19)18-12-7-3-6-11-14(12)16(21)10-5-2-1-4-9(10)15(11)20/h1-7H,8H2,(H,18,19) |
| InChIKey | MAUPEUPHEPMTIE-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.16 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|