C24H28N4O6 — CID 102155791
3-(2-hydroxyethylamino)-N-[5-[3-(2-hydroxyethylamino)propanoylamino]-9,10-dioxoanthracen-1-yl]propanamide (PubChem CID 102155791) has the molecular formula C24H28N4O6 and a molecular weight of 468.51 g/mol. Its IUPAC name is 3-(2-hydroxyethylamino)-N-[5-[3-(2-hydroxyethylamino)propanoylamino]-9,10-dioxoanthracen-1-yl]propanamide.
| Compound Name | 3-(2-hydroxyethylamino)-N-[5-[3-(2-hydroxyethylamino)propanoylamino]-9,10-dioxoanthracen-1-yl]propanamide |
|---|---|
| PubChem CID | 102155791 |
| Molecular Formula | C24H28N4O6 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | 3-(2-hydroxyethylamino)-N-[5-[3-(2-hydroxyethylamino)propanoylamino]-9,10-dioxoanthracen-1-yl]propanamide |
| SMILES | O=C(CCNCCO)Nc1cccc2c1C(=O)c1cccc(NC(=O)CCNCCO)c1C2=O |
| InChI | InChI=1S/C24H28N4O6/c29-13-11-25-9-7-19(31)27-17-5-1-3-15-21(17)24(34)16-4-2-6-18(22(16)23(15)33)28-20(32)8-10-26-12-14-30/h1-6,25-26,29-30H,7-14H2,(H,27,31)(H,28,32) |
| InChIKey | QWLUVSMWNRHNLO-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 156.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|