C30H38N4O6+2 — CID 10747944
3-(4-methylmorpholin-4-ium-4-yl)-N-[5-[3-(4-methylmorpholin-4-ium-4-yl)propanoylamino]-9,10-dioxoanthracen-1-yl]propanamide (PubChem CID 10747944) has the molecular formula C30H38N4O6+2 and a molecular weight of 550.66 g/mol. Its IUPAC name is 3-(4-methylmorpholin-4-ium-4-yl)-N-[5-[3-(4-methylmorpholin-4-ium-4-yl)propanoylamino]-9,10-dioxoanthracen-1-yl]propanamide.
| Compound Name | 3-(4-methylmorpholin-4-ium-4-yl)-N-[5-[3-(4-methylmorpholin-4-ium-4-yl)propanoylamino]-9,10-dioxoanthracen-1-yl]propanamide |
|---|---|
| PubChem CID | 10747944 |
| Molecular Formula | C30H38N4O6+2 |
| Molecular Weight | 550.66 g/mol |
| Exact Mass | 550.28 |
| IUPAC Name | 3-(4-methylmorpholin-4-ium-4-yl)-N-[5-[3-(4-methylmorpholin-4-ium-4-yl)propanoylamino]-9,10-dioxoanthracen-1-yl]propanamide |
| SMILES | C[N+]1(CCC(=O)Nc2cccc3c2C(=O)c2cccc(NC(=O)CC[N+]4(C)CCOCC4)c2C3=O)CCOCC1 |
| InChI | InChI=1S/C30H36N4O6/c1-33(13-17-39-18-14-33)11-9-25(35)31-23-7-3-5-21-27(23)29(37)22-6-4-8-24(28(22)30(21)38)32-26(36)10-12-34(2)15-19-40-20-16-34/h3-8H,9-20H2,1-2H3/p+2 |
| InChIKey | UVXZYPRCYXKDII-UHFFFAOYSA-P |
| XLogP | 2.07 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.66 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|