C30H38I2N4O4 — CID 10652779
3-(1-methylpyrrolidin-1-ium-1-yl)-N-[8-[3-(1-methylpyrrolidin-1-ium-1-yl)propanoylamino]-9,10-dioxoanthracen-1-yl]propanamide diiodide (PubChem CID 10652779) has the molecular formula C30H38I2N4O4 and a molecular weight of 772.47 g/mol. Its IUPAC name is 3-(1-methylpyrrolidin-1-ium-1-yl)-N-[8-[3-(1-methylpyrrolidin-1-ium-1-yl)propanoylamino]-9,10-dioxoanthracen-1-yl]propanamide diiodide.
| Compound Name | 3-(1-methylpyrrolidin-1-ium-1-yl)-N-[8-[3-(1-methylpyrrolidin-1-ium-1-yl)propanoylamino]-9,10-dioxoanthracen-1-yl]propanamide diiodide |
|---|---|
| PubChem CID | 10652779 |
| Molecular Formula | C30H38I2N4O4 |
| Molecular Weight | 772.47 g/mol |
| Exact Mass | 772.10 |
| IUPAC Name | 3-(1-methylpyrrolidin-1-ium-1-yl)-N-[8-[3-(1-methylpyrrolidin-1-ium-1-yl)propanoylamino]-9,10-dioxoanthracen-1-yl]propanamide diiodide |
| SMILES | C[N+]1(CCC(=O)Nc2cccc3c2C(=O)c2c(NC(=O)CC[N+]4(C)CCCC4)cccc2C3=O)CCCC1.[I-].[I-] |
| InChI | InChI=1S/C30H36N4O4.2HI/c1-33(15-3-4-16-33)19-13-25(35)31-23-11-7-9-21-27(23)30(38)28-22(29(21)37)10-8-12-24(28)32-26(36)14-20-34(2)17-5-6-18-34;;/h7-12H,3-6,13-20H2,1-2H3;2*1H |
| InChIKey | SAHVGJKUTZLENU-UHFFFAOYSA-N |
| XLogP | -2.39 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.47 |
| LogP ≤ 5 | -2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|