C23H24N2O3 — CID 8930746
2-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-N-(9,10-dioxoanthracen-1-yl)acetamide (PubChem CID 8930746) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is 2-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-N-(9,10-dioxoanthracen-1-yl)acetamide.
| Compound Name | 2-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-N-(9,10-dioxoanthracen-1-yl)acetamide |
|---|---|
| PubChem CID | 8930746 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 2-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-N-(9,10-dioxoanthracen-1-yl)acetamide |
| SMILES | C[C@@H]1C[C@H](C)CN(CC(=O)Nc2cccc3c2C(=O)c2ccccc2C3=O)C1 |
| InChI | InChI=1S/C23H24N2O3/c1-14-10-15(2)12-25(11-14)13-20(26)24-19-9-5-8-18-21(19)23(28)17-7-4-3-6-16(17)22(18)27/h3-9,14-15H,10-13H2,1-2H3,(H,24,26)/t14-,15+ |
| InChIKey | NJJKISRXABHUPE-GASCZTMLSA-N |
| XLogP | 3.38 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|