C21H20N2O3 — CID 3849711
N-(9,10-dioxoanthracen-1-yl)-2-piperidin-1-ylacetamide (PubChem CID 3849711) has the molecular formula C21H20N2O3 and a molecular weight of 348.40 g/mol. Its IUPAC name is N-(9,10-dioxoanthracen-1-yl)-2-piperidin-1-ylacetamide.
| Compound Name | N-(9,10-dioxoanthracen-1-yl)-2-piperidin-1-ylacetamide |
|---|---|
| PubChem CID | 3849711 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | N-(9,10-dioxoanthracen-1-yl)-2-piperidin-1-ylacetamide |
| SMILES | O=C(CN1CCCCC1)Nc1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C21H20N2O3/c24-18(13-23-11-4-1-5-12-23)22-17-10-6-9-16-19(17)21(26)15-8-3-2-7-14(15)20(16)25/h2-3,6-10H,1,4-5,11-13H2,(H,22,24) |
| InChIKey | SBLYAYXFYIBBQZ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|