C25H20N2O3 — CID 27131729
2-(3,4-dihydro-2H-quinolin-1-yl)-N-(9,10-dioxoanthracen-1-yl)acetamide (PubChem CID 27131729) has the molecular formula C25H20N2O3 and a molecular weight of 396.45 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-quinolin-1-yl)-N-(9,10-dioxoanthracen-1-yl)acetamide.
| Compound Name | 2-(3,4-dihydro-2H-quinolin-1-yl)-N-(9,10-dioxoanthracen-1-yl)acetamide |
|---|---|
| PubChem CID | 27131729 |
| Molecular Formula | C25H20N2O3 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | 2-(3,4-dihydro-2H-quinolin-1-yl)-N-(9,10-dioxoanthracen-1-yl)acetamide |
| SMILES | O=C(CN1CCCc2ccccc21)Nc1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C25H20N2O3/c28-22(15-27-14-6-8-16-7-1-4-13-21(16)27)26-20-12-5-11-19-23(20)25(30)18-10-3-2-9-17(18)24(19)29/h1-5,7,9-13H,6,8,14-15H2,(H,26,28) |
| InChIKey | QCMBQMPCSYIJPA-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|