C28H36N4O2 — CID 14320115
1,5-bis(2-piperidin-1-ylethylamino)anthracene-9,10-dione (PubChem CID 14320115) has the molecular formula C28H36N4O2 and a molecular weight of 460.62 g/mol. Its IUPAC name is 1,5-bis(2-piperidin-1-ylethylamino)anthracene-9,10-dione.
| Compound Name | 1,5-bis(2-piperidin-1-ylethylamino)anthracene-9,10-dione |
|---|---|
| PubChem CID | 14320115 |
| Molecular Formula | C28H36N4O2 |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.28 |
| IUPAC Name | 1,5-bis(2-piperidin-1-ylethylamino)anthracene-9,10-dione |
| SMILES | O=C1c2cccc(NCCN3CCCCC3)c2C(=O)c2cccc(NCCN3CCCCC3)c21 |
| InChI | InChI=1S/C28H36N4O2/c33-27-22-10-8-12-24(30-14-20-32-17-5-2-6-18-32)26(22)28(34)21-9-7-11-23(25(21)27)29-13-19-31-15-3-1-4-16-31/h7-12,29-30H,1-6,13-20H2 |
| InChIKey | AKKUUYSFUYLIAS-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|