C21H22Cl2N2O2 — CID 11994254
1-[2-[2-(chloromethyl)pyrrolidin-1-yl]ethylamino]anthracene-9,10-dione;hydrochloride (PubChem CID 11994254) has the molecular formula C21H22Cl2N2O2 and a molecular weight of 405.33 g/mol. Its IUPAC name is 1-[2-[2-(chloromethyl)pyrrolidin-1-yl]ethylamino]anthracene-9,10-dione;hydrochloride.
| Compound Name | 1-[2-[2-(chloromethyl)pyrrolidin-1-yl]ethylamino]anthracene-9,10-dione;hydrochloride |
|---|---|
| PubChem CID | 11994254 |
| Molecular Formula | C21H22Cl2N2O2 |
| Molecular Weight | 405.33 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | 1-[2-[2-(chloromethyl)pyrrolidin-1-yl]ethylamino]anthracene-9,10-dione;hydrochloride |
| SMILES | Cl.O=C1c2ccccc2C(=O)c2c(NCCN3CCCC3CCl)cccc21 |
| InChI | InChI=1S/C21H21ClN2O2.ClH/c22-13-14-5-4-11-24(14)12-10-23-18-9-3-8-17-19(18)21(26)16-7-2-1-6-15(16)20(17)25;/h1-3,6-9,14,23H,4-5,10-13H2;1H |
| InChIKey | CKQHMECNONZATD-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.33 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|