C17H14ClNO3 — CID 3142375
1-[(3-chloro-2-hydroxypropyl)amino]anthracene-9,10-dione (PubChem CID 3142375) has the molecular formula C17H14ClNO3 and a molecular weight of 315.76 g/mol. Its IUPAC name is 1-[(3-chloro-2-hydroxypropyl)amino]anthracene-9,10-dione.
| Compound Name | 1-[(3-chloro-2-hydroxypropyl)amino]anthracene-9,10-dione |
|---|---|
| PubChem CID | 3142375 |
| Molecular Formula | C17H14ClNO3 |
| Molecular Weight | 315.76 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 1-[(3-chloro-2-hydroxypropyl)amino]anthracene-9,10-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c(NCC(O)CCl)cccc21 |
| InChI | InChI=1S/C17H14ClNO3/c18-8-10(20)9-19-14-7-3-6-13-15(14)17(22)12-5-2-1-4-11(12)16(13)21/h1-7,10,19-20H,8-9H2 |
| InChIKey | QVNLDKAGSINHJE-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.76 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|