C24H28ClN3O4 — CID 118498985
1-[[(2S)-3-chloro-2-hydroxypropyl]amino]-4-(3-morpholin-4-ylpropylamino)anthracene-9,10-dione (PubChem CID 118498985) has the molecular formula C24H28ClN3O4 and a molecular weight of 457.96 g/mol. Its IUPAC name is 1-[[(2S)-3-chloro-2-hydroxypropyl]amino]-4-(3-morpholin-4-ylpropylamino)anthracene-9,10-dione.
| Compound Name | 1-[[(2S)-3-chloro-2-hydroxypropyl]amino]-4-(3-morpholin-4-ylpropylamino)anthracene-9,10-dione |
|---|---|
| PubChem CID | 118498985 |
| Molecular Formula | C24H28ClN3O4 |
| Molecular Weight | 457.96 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | 1-[[(2S)-3-chloro-2-hydroxypropyl]amino]-4-(3-morpholin-4-ylpropylamino)anthracene-9,10-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c(NC[C@H](O)CCl)ccc(NCCCN3CCOCC3)c21 |
| InChI | InChI=1S/C24H28ClN3O4/c25-14-16(29)15-27-20-7-6-19(26-8-3-9-28-10-12-32-13-11-28)21-22(20)24(31)18-5-2-1-4-17(18)23(21)30/h1-2,4-7,16,26-27,29H,3,8-15H2/t16-/m1/s1 |
| InChIKey | UELORFQADSGHHG-MRXNPFEDSA-N |
| XLogP | 2.61 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.96 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|