C20H22ClN3O3 — CID 166725648
1-[3-[(2-chloro-1-hydroxyethyl)amino]propylamino]-4-(methylamino)anthracene-9,10-dione (PubChem CID 166725648) has the molecular formula C20H22ClN3O3 and a molecular weight of 387.87 g/mol. Its IUPAC name is 1-[3-[(2-chloro-1-hydroxyethyl)amino]propylamino]-4-(methylamino)anthracene-9,10-dione.
| Compound Name | 1-[3-[(2-chloro-1-hydroxyethyl)amino]propylamino]-4-(methylamino)anthracene-9,10-dione |
|---|---|
| PubChem CID | 166725648 |
| Molecular Formula | C20H22ClN3O3 |
| Molecular Weight | 387.87 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 1-[3-[(2-chloro-1-hydroxyethyl)amino]propylamino]-4-(methylamino)anthracene-9,10-dione |
| SMILES | CNc1ccc(NCCCNC(O)CCl)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C20H22ClN3O3/c1-22-14-7-8-15(23-9-4-10-24-16(25)11-21)18-17(14)19(26)12-5-2-3-6-13(12)20(18)27/h2-3,5-8,16,22-25H,4,9-11H2,1H3 |
| InChIKey | UBCZLBHNKPCMDW-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.87 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|