C24H34N4O4 — CID 171638845
1,4-bis[2-(2-hydroxyethylamino)ethylamino]anthracene-9,10-dione;ethane (PubChem CID 171638845) has the molecular formula C24H34N4O4 and a molecular weight of 442.56 g/mol. Its IUPAC name is 1,4-bis[2-(2-hydroxyethylamino)ethylamino]anthracene-9,10-dione;ethane.
| Compound Name | 1,4-bis[2-(2-hydroxyethylamino)ethylamino]anthracene-9,10-dione;ethane |
|---|---|
| PubChem CID | 171638845 |
| Molecular Formula | C24H34N4O4 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | 1,4-bis[2-(2-hydroxyethylamino)ethylamino]anthracene-9,10-dione;ethane |
| SMILES | CC.O=C1c2ccccc2C(=O)c2c(NCCNCCO)ccc(NCCNCCO)c21 |
| InChI | InChI=1S/C22H28N4O4.C2H6/c27-13-11-23-7-9-25-17-5-6-18(26-10-8-24-12-14-28)20-19(17)21(29)15-3-1-2-4-16(15)22(20)30;1-2/h1-6,23-28H,7-14H2;1-2H3 |
| InChIKey | JVCFMCITELQEAB-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 122.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|