C24H30N6O4 — CID 54590172
(2S)-2-amino-N-[2-[[4-[2-[[(2S)-2-aminopropanoyl]amino]ethylamino]-9,10-dioxoanthracen-1-yl]amino]ethyl]propanamide (PubChem CID 54590172) has the molecular formula C24H30N6O4 and a molecular weight of 466.54 g/mol. Its IUPAC name is (2S)-2-amino-N-[2-[[4-[2-[[(2S)-2-aminopropanoyl]amino]ethylamino]-9,10-dioxoanthracen-1-yl]amino]ethyl]propanamide.
| Compound Name | (2S)-2-amino-N-[2-[[4-[2-[[(2S)-2-aminopropanoyl]amino]ethylamino]-9,10-dioxoanthracen-1-yl]amino]ethyl]propanamide |
|---|---|
| PubChem CID | 54590172 |
| Molecular Formula | C24H30N6O4 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.23 |
| IUPAC Name | (2S)-2-amino-N-[2-[[4-[2-[[(2S)-2-aminopropanoyl]amino]ethylamino]-9,10-dioxoanthracen-1-yl]amino]ethyl]propanamide |
| SMILES | C[C@H](N)C(=O)NCCNc1ccc(NCCNC(=O)[C@H](C)N)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C24H30N6O4/c1-13(25)23(33)29-11-9-27-17-7-8-18(28-10-12-30-24(34)14(2)26)20-19(17)21(31)15-5-3-4-6-16(15)22(20)32/h3-8,13-14,27-28H,9-12,25-26H2,1-2H3,(H,29,33)(H,30,34)/t13-,14-/m0/s1 |
| InChIKey | JMMUORYMZSKWFT-KBPBESRZSA-N |
| XLogP | 0.21 |
| TPSA | 168.44 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|