C18H20N4O2 — CID 68952236
1,4-bis(1-aminoethylamino)anthracene-9,10-dione (PubChem CID 68952236) has the molecular formula C18H20N4O2 and a molecular weight of 324.38 g/mol. Its IUPAC name is 1,4-bis(1-aminoethylamino)anthracene-9,10-dione.
| Compound Name | 1,4-bis(1-aminoethylamino)anthracene-9,10-dione |
|---|---|
| PubChem CID | 68952236 |
| Molecular Formula | C18H20N4O2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 1,4-bis(1-aminoethylamino)anthracene-9,10-dione |
| SMILES | CC(N)Nc1ccc(NC(C)N)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C18H20N4O2/c1-9(19)21-13-7-8-14(22-10(2)20)16-15(13)17(23)11-5-3-4-6-12(11)18(16)24/h3-10,21-22H,19-20H2,1-2H3 |
| InChIKey | BRSSLUCNLSRFFL-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|