C18H19N2O2+ — CID 23591271
dimethyl-[[(4-methyl-9,10-dioxoanthracen-1-yl)amino]methyl]azanium (PubChem CID 23591271) has the molecular formula C18H19N2O2+ and a molecular weight of 295.36 g/mol. Its IUPAC name is dimethyl-[[(4-methyl-9,10-dioxoanthracen-1-yl)amino]methyl]azanium.
| Compound Name | dimethyl-[[(4-methyl-9,10-dioxoanthracen-1-yl)amino]methyl]azanium |
|---|---|
| PubChem CID | 23591271 |
| Molecular Formula | C18H19N2O2+ |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | dimethyl-[[(4-methyl-9,10-dioxoanthracen-1-yl)amino]methyl]azanium |
| SMILES | Cc1ccc(NC[NH+](C)C)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C18H18N2O2/c1-11-8-9-14(19-10-20(2)3)16-15(11)17(21)12-6-4-5-7-13(12)18(16)22/h4-9,19H,10H2,1-3H3/p+1 |
| InChIKey | XWZMXBRHWBUABG-UHFFFAOYSA-O |
| XLogP | 1.28 |
| TPSA | 50.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|