C17H16N2O5S — CID 135183157
2-[[4-(methylamino)-9,10-dioxoanthracen-1-yl]amino]ethanesulfonic acid (PubChem CID 135183157) has the molecular formula C17H16N2O5S and a molecular weight of 360.39 g/mol. Its IUPAC name is 2-[[4-(methylamino)-9,10-dioxoanthracen-1-yl]amino]ethanesulfonic acid.
| Compound Name | 2-[[4-(methylamino)-9,10-dioxoanthracen-1-yl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 135183157 |
| Molecular Formula | C17H16N2O5S |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 2-[[4-(methylamino)-9,10-dioxoanthracen-1-yl]amino]ethanesulfonic acid |
| SMILES | CNc1ccc(NCCS(=O)(=O)O)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C17H16N2O5S/c1-18-12-6-7-13(19-8-9-25(22,23)24)15-14(12)16(20)10-4-2-3-5-11(10)17(15)21/h2-7,18-19H,8-9H2,1H3,(H,22,23,24) |
| InChIKey | RKMRDQXJDCINLQ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|