C22H24N4O6S — CID 18769524
hydron;1-(methylamino)-4-[3-(3-methylimidazol-3-ium-1-yl)propylamino]anthracene-9,10-dione;sulfate (PubChem CID 18769524) has the molecular formula C22H24N4O6S and a molecular weight of 472.52 g/mol. Its IUPAC name is hydron;1-(methylamino)-4-[3-(3-methylimidazol-3-ium-1-yl)propylamino]anthracene-9,10-dione;sulfate.
| Compound Name | hydron;1-(methylamino)-4-[3-(3-methylimidazol-3-ium-1-yl)propylamino]anthracene-9,10-dione;sulfate |
|---|---|
| PubChem CID | 18769524 |
| Molecular Formula | C22H24N4O6S |
| Molecular Weight | 472.52 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | hydron;1-(methylamino)-4-[3-(3-methylimidazol-3-ium-1-yl)propylamino]anthracene-9,10-dione;sulfate |
| SMILES | CNc1ccc(NCCCn2cc[n+](C)c2)c2c1C(=O)c1ccccc1C2=O.O=S(=O)([O-])[O-].[H+] |
| InChI | InChI=1S/C22H22N4O2.H2O4S/c1-23-17-8-9-18(24-10-5-11-26-13-12-25(2)14-26)20-19(17)21(27)15-6-3-4-7-16(15)22(20)28;1-5(2,3)4/h3-4,6-9,12-14H,5,10-11H2,1-2H3,(H-,23,24,27,28);(H2,1,2,3,4) |
| InChIKey | RGMYLQMAZUMIKH-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 147.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.52 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|