C8H16N2O7S2 — CID 11290044
hydrogen sulfate;4-(3-methylimidazol-3-ium-1-yl)butane-1-sulfonic acid (PubChem CID 11290044) has the molecular formula C8H16N2O7S2 and a molecular weight of 316.36 g/mol. Its IUPAC name is hydrogen sulfate;4-(3-methylimidazol-3-ium-1-yl)butane-1-sulfonic acid.
| Compound Name | hydrogen sulfate;4-(3-methylimidazol-3-ium-1-yl)butane-1-sulfonic acid |
|---|---|
| PubChem CID | 11290044 |
| Molecular Formula | C8H16N2O7S2 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | hydrogen sulfate;4-(3-methylimidazol-3-ium-1-yl)butane-1-sulfonic acid |
| SMILES | C[n+]1ccn(CCCCS(=O)(=O)O)c1.O=S(=O)([O-])O |
| InChI | InChI=1S/C8H14N2O3S.H2O4S/c1-9-5-6-10(8-9)4-2-3-7-14(11,12)13;1-5(2,3)4/h5-6,8H,2-4,7H2,1H3;(H2,1,2,3,4) |
| InChIKey | IEKJIBPFXKAASL-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 140.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|