C24H46N4O6S2 — CID 140766452
butane-1,4-disulfonate;bis(1-hexyl-3-methylimidazol-3-ium) (PubChem CID 140766452) has the molecular formula C24H46N4O6S2 and a molecular weight of 550.79 g/mol. Its IUPAC name is butane-1,4-disulfonate;bis(1-hexyl-3-methylimidazol-3-ium).
| Compound Name | butane-1,4-disulfonate;bis(1-hexyl-3-methylimidazol-3-ium) |
|---|---|
| PubChem CID | 140766452 |
| Molecular Formula | C24H46N4O6S2 |
| Molecular Weight | 550.79 g/mol |
| Exact Mass | 550.29 |
| IUPAC Name | butane-1,4-disulfonate;bis(1-hexyl-3-methylimidazol-3-ium) |
| SMILES | CCCCCCn1cc[n+](C)c1.CCCCCCn1cc[n+](C)c1.O=S(=O)([O-])CCCCS(=O)(=O)[O-] |
| InChI | InChI=1S/2C10H19N2.C4H10O6S2/c2*1-3-4-5-6-7-12-9-8-11(2)10-12;5-11(6,7)3-1-2-4-12(8,9)10/h2*8-10H,3-7H2,1-2H3;1-4H2,(H,5,6,7)(H,8,9,10)/q2*+1;/p-2 |
| InChIKey | DSNPCIFWCVESOX-UHFFFAOYSA-L |
| XLogP | 2.64 |
| TPSA | 132.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.79 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|