C29H50N2O3S — CID 21260126
4-methylbenzenesulfonate;1-methyl-3-octadecylimidazol-1-ium (PubChem CID 21260126) has the molecular formula C29H50N2O3S and a molecular weight of 506.80 g/mol. Its IUPAC name is 4-methylbenzenesulfonate;1-methyl-3-octadecylimidazol-1-ium.
| Compound Name | 4-methylbenzenesulfonate;1-methyl-3-octadecylimidazol-1-ium |
|---|---|
| PubChem CID | 21260126 |
| Molecular Formula | C29H50N2O3S |
| Molecular Weight | 506.80 g/mol |
| Exact Mass | 506.35 |
| IUPAC Name | 4-methylbenzenesulfonate;1-methyl-3-octadecylimidazol-1-ium |
| SMILES | CCCCCCCCCCCCCCCCCCn1cc[n+](C)c1.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C22H43N2.C7H8O3S/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-24-21-20-23(2)22-24;1-6-2-4-7(5-3-6)11(8,9)10/h20-22H,3-19H2,1-2H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1 |
| InChIKey | LORSIKZOULPENU-UHFFFAOYSA-M |
| XLogP | 7.47 |
| TPSA | 66.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.80 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|