C14H17N3O3S — CID 154726167
4-methylbenzenesulfonate;3-(3-methylimidazol-3-ium-1-yl)propanenitrile (PubChem CID 154726167) has the molecular formula C14H17N3O3S and a molecular weight of 307.38 g/mol. Its IUPAC name is 4-methylbenzenesulfonate;3-(3-methylimidazol-3-ium-1-yl)propanenitrile.
| Compound Name | 4-methylbenzenesulfonate;3-(3-methylimidazol-3-ium-1-yl)propanenitrile |
|---|---|
| PubChem CID | 154726167 |
| Molecular Formula | C14H17N3O3S |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 4-methylbenzenesulfonate;3-(3-methylimidazol-3-ium-1-yl)propanenitrile |
| SMILES | C[n+]1ccn(CCC#N)c1.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C7H10N3.C7H8O3S/c1-9-5-6-10(7-9)4-2-3-8;1-6-2-4-7(5-3-6)11(8,9)10/h5-7H,2,4H2,1H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1 |
| InChIKey | BOFWLPHDTMEHJL-UHFFFAOYSA-M |
| XLogP | 1.13 |
| TPSA | 89.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|