About dimethylphosphanium;4-methylbenzenesulfonate
dimethylphosphanium;4-methylbenzenesulfonate (PubChem CID 157165393) has the molecular formula C9H15O3PS
and a molecular weight of 234.26 g/mol. Its IUPAC name is dimethylphosphanium;4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | dimethylphosphanium;4-methylbenzenesulfonate |
| PubChem CID | 157165393 |
| Molecular Formula | C9H15O3PS |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | dimethylphosphanium;4-methylbenzenesulfonate |
| SMILES | C[PH2+]C.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C7H8O3S.C2H7P/c1-6-2-4-7(5-3-6)11(8,9)10;1-3-2/h2-5H,1H3,(H,8,9,10);3H,1-2H3 |
| InChIKey | AMVSYJXTJNDKOU-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze dimethylphosphanium;4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethylphosphanium;4-methylbenzenesulfonate?
The IUPAC name of dimethylphosphanium;4-methylbenzenesulfonate (CID 157165393) is dimethylphosphanium;4-methylbenzenesulfonate.
What is the SMILES notation for dimethylphosphanium;4-methylbenzenesulfonate?
The canonical SMILES for dimethylphosphanium;4-methylbenzenesulfonate is C[PH2+]C.Cc1ccc(S(=O)(=O)[O-])cc1.
What is the InChIKey of dimethylphosphanium;4-methylbenzenesulfonate?
The InChIKey is AMVSYJXTJNDKOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O3S.C2H7P/c1-6-2-4-7(5-3-6)11(8,9)10;1-3-2/h2-5H,1H3,(H,8,9,10);3H,1-2H3.
What are the key properties of dimethylphosphanium;4-methylbenzenesulfonate?
dimethylphosphanium;4-methylbenzenesulfonate has a molecular weight of 234.26 g/mol, XLogP of 1.56, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dimethylphosphanium;4-methylbenzenesulfonate is sourced from PubChem (CID 157165393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).