C32H30O3S2 — CID 87522525
benzenesulfonate;triphenylsulfanium;1,4-xylene (PubChem CID 87522525) has the molecular formula C32H30O3S2 and a molecular weight of 526.72 g/mol. Its IUPAC name is benzenesulfonate;triphenylsulfanium;1,4-xylene.
| Compound Name | benzenesulfonate;triphenylsulfanium;1,4-xylene |
|---|---|
| PubChem CID | 87522525 |
| Molecular Formula | C32H30O3S2 |
| Molecular Weight | 526.72 g/mol |
| Exact Mass | 526.16 |
| IUPAC Name | benzenesulfonate;triphenylsulfanium;1,4-xylene |
| SMILES | Cc1ccc(C)cc1.O=S(=O)([O-])c1ccccc1.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C8H10.C6H6O3S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-7-3-5-8(2)6-4-7;7-10(8,9)6-4-2-1-3-5-6/h1-15H;3-6H,1-2H3;1-5H,(H,7,8,9)/q+1;;/p-1 |
| InChIKey | FBAGPHOHASMMTR-UHFFFAOYSA-M |
| XLogP | 7.68 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.72 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|