About benzenesulfonate;tris(4-methylphenyl)sulfanium
benzenesulfonate;tris(4-methylphenyl)sulfanium (PubChem CID 22481329) has the molecular formula C27H26O3S2
and a molecular weight of 462.64 g/mol. Its IUPAC name is benzenesulfonate;tris(4-methylphenyl)sulfanium.
Molecular Properties
| Compound Name | benzenesulfonate;tris(4-methylphenyl)sulfanium |
| PubChem CID | 22481329 |
| Molecular Formula | C27H26O3S2 |
| Molecular Weight | 462.64 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | benzenesulfonate;tris(4-methylphenyl)sulfanium |
| SMILES | Cc1ccc([S+](c2ccc(C)cc2)c2ccc(C)cc2)cc1.O=S(=O)([O-])c1ccccc1 |
| InChI | InChI=1S/C21H21S.C6H6O3S/c1-16-4-10-19(11-5-16)22(20-12-6-17(2)7-13-20)21-14-8-18(3)9-15-21;7-10(8,9)6-4-2-1-3-5-6/h4-15H,1-3H3;1-5H,(H,7,8,9)/q+1;/p-1 |
| InChIKey | NPJDMLKGUZRTJZ-UHFFFAOYSA-M |
| XLogP | 6.30 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 462.64 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze benzenesulfonate;tris(4-methylphenyl)sulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzenesulfonate;tris(4-methylphenyl)sulfanium?
The IUPAC name of benzenesulfonate;tris(4-methylphenyl)sulfanium (CID 22481329) is benzenesulfonate;tris(4-methylphenyl)sulfanium.
What is the SMILES notation for benzenesulfonate;tris(4-methylphenyl)sulfanium?
The canonical SMILES for benzenesulfonate;tris(4-methylphenyl)sulfanium is Cc1ccc([S+](c2ccc(C)cc2)c2ccc(C)cc2)cc1.O=S(=O)([O-])c1ccccc1.
What is the InChIKey of benzenesulfonate;tris(4-methylphenyl)sulfanium?
The InChIKey is NPJDMLKGUZRTJZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C21H21S.C6H6O3S/c1-16-4-10-19(11-5-16)22(20-12-6-17(2)7-13-20)21-14-8-18(3)9-15-21;7-10(8,9)6-4-2-1-3-5-6/h4-15H,1-3H3;1-5H,(H,7,8,9)/q+1;/p-1.
What are the key properties of benzenesulfonate;tris(4-methylphenyl)sulfanium?
benzenesulfonate;tris(4-methylphenyl)sulfanium has a molecular weight of 462.64 g/mol, XLogP of 6.30, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzenesulfonate;tris(4-methylphenyl)sulfanium is sourced from PubChem (CID 22481329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).