C15H18O4S2 — CID 162338920
hydroxymethyl-methyl-phenylsulfanium;4-methylbenzenesulfonate (PubChem CID 162338920) has the molecular formula C15H18O4S2 and a molecular weight of 326.44 g/mol. Its IUPAC name is hydroxymethyl-methyl-phenylsulfanium;4-methylbenzenesulfonate.
| Compound Name | hydroxymethyl-methyl-phenylsulfanium;4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 162338920 |
| Molecular Formula | C15H18O4S2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | hydroxymethyl-methyl-phenylsulfanium;4-methylbenzenesulfonate |
| SMILES | C[S+](CO)c1ccccc1.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C8H11OS.C7H8O3S/c1-10(7-9)8-5-3-2-4-6-8;1-6-2-4-7(5-3-6)11(8,9)10/h2-6,9H,7H2,1H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1 |
| InChIKey | KOTMHBQPDNOHIL-UHFFFAOYSA-M |
| XLogP | 2.14 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|