C9H10F3O4S- — CID 131722453
4-methylbenzenesulfonate;2,2,2-trifluoroethanol (PubChem CID 131722453) has the molecular formula C9H10F3O4S- and a molecular weight of 271.24 g/mol. Its IUPAC name is 4-methylbenzenesulfonate;2,2,2-trifluoroethanol.
| Compound Name | 4-methylbenzenesulfonate;2,2,2-trifluoroethanol |
|---|---|
| PubChem CID | 131722453 |
| Molecular Formula | C9H10F3O4S- |
| Molecular Weight | 271.24 g/mol |
| Exact Mass | 271.03 |
| IUPAC Name | 4-methylbenzenesulfonate;2,2,2-trifluoroethanol |
| SMILES | Cc1ccc(S(=O)(=O)[O-])cc1.OCC(F)(F)F |
| InChI | InChI=1S/C7H8O3S.C2H3F3O/c1-6-2-4-7(5-3-6)11(8,9)10;3-2(4,5)1-6/h2-5H,1H3,(H,8,9,10);6H,1H2/p-1 |
| InChIKey | WMDAMARHMIDSDD-UHFFFAOYSA-M |
| XLogP | 1.44 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.24 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|