About sodium;deuterated water;4-methylbenzenesulfonate
sodium;deuterated water;4-methylbenzenesulfonate (PubChem CID 121303478) has the molecular formula C7H9NaO4S
and a molecular weight of 214.21 g/mol. Its IUPAC name is sodium;deuterated water;4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | sodium;deuterated water;4-methylbenzenesulfonate |
| PubChem CID | 121303478 |
| Molecular Formula | C7H9NaO4S |
| Molecular Weight | 214.21 g/mol |
| Exact Mass | 214.02 |
| IUPAC Name | sodium;deuterated water;4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)[O-])cc1.[2H]O[2H].[Na+] |
| InChI | InChI=1S/C7H8O3S.Na.H2O/c1-6-2-4-7(5-3-6)11(8,9)10;;/h2-5H,1H3,(H,8,9,10);;1H2/q;+1;/p-1/i/hD2 |
| InChIKey | QWXIVCIRWMNTJB-ZSJDYOACSA-M |
| XLogP | -2.92 |
| TPSA | 88.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.21 |
| LogP ≤ 5 | -2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;deuterated water;4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;deuterated water;4-methylbenzenesulfonate?
The IUPAC name of sodium;deuterated water;4-methylbenzenesulfonate (CID 121303478) is sodium;deuterated water;4-methylbenzenesulfonate.
What is the SMILES notation for sodium;deuterated water;4-methylbenzenesulfonate?
The canonical SMILES for sodium;deuterated water;4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)[O-])cc1.[2H]O[2H].[Na+].
What is the InChIKey of sodium;deuterated water;4-methylbenzenesulfonate?
The InChIKey is QWXIVCIRWMNTJB-ZSJDYOACSA-M. The full InChI is InChI=1S/C7H8O3S.Na.H2O/c1-6-2-4-7(5-3-6)11(8,9)10;;/h2-5H,1H3,(H,8,9,10);;1H2/q;+1;/p-1/i/hD2.
What are the key properties of sodium;deuterated water;4-methylbenzenesulfonate?
sodium;deuterated water;4-methylbenzenesulfonate has a molecular weight of 214.21 g/mol, XLogP of -2.92, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;deuterated water;4-methylbenzenesulfonate is sourced from PubChem (CID 121303478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).